hydron; methyl 2-azanyl-3-methyl-butanoate; chloride

Systemtic Name: hydron; methyl 2-azanyl-3-methyl-butanoate; chloride Openeye Name: hydron; methyl 2-amino-3-methyl-butanoate; chloride CAS Name: 2-amino-3-methylbutanoic acid methyl ester; hydron; chloride IUPAC Name: hydron; methyl 2-amino-3-methylbutanoate; chloride Traditional Name: 2-amino-3-methyl-butyric acid methyl ester; hydron; chloride Formula: C6H14ClNO2 MolecularWeight: 167.63386

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CC(C)C(C(=O)OC)N.[Cl-]

Isomeric SMILES

[H+].CC(C)C(C(=O)OC)N.[Cl-]

InChI

InChI=1S/C6H13NO2.ClH/c1-4(2)5(7)6(8)9-3;/h4-5H,7H2,1-3H3;1H