hydron; methyl 2-azanyl-4-methyl-pentanoate; chloride

Systemtic Name: hydron; methyl 2-azanyl-4-methyl-pentanoate; chloride Openeye Name: hydron; methyl 2-amino-4-methyl-pentanoate; chloride CAS Name: 2-amino-4-methylpentanoic acid methyl ester; hydron; chloride IUPAC Name: hydron; methyl 2-amino-4-methylpentanoate; chloride Traditional Name: 2-amino-4-methyl-valeric acid methyl ester; hydron; chloride Formula: C7H16ClNO2 MolecularWeight: 181.66044

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CC(C)CC(C(=O)OC)N.[Cl-]

Isomeric SMILES

[H+].CC(C)CC(C(=O)OC)N.[Cl-]

InChI

InChI=1S/C7H15NO2.ClH/c1-5(2)4-6(8)7(9)10-3;/h5-6H,4,8H2,1-3H3;1H