3-(dimethylamino)propyl 3-phenylpropanoate; hydron; chloride

Systemtic Name: 3-(dimethylamino)propyl 3-phenylpropanoate; hydron; chloride Openeye Name: 3-(dimethylamino)propyl 3-phenylpropanoate; hydron; chloride CAS Name: hydron; 3-phenylpropanoic acid 3-(dimethylamino)propyl ester; chloride IUPAC Name: 3-(dimethylamino)propyl 3-phenylpropanoate; hydron; chloride Traditional Name: hydron; 3-phenylpropionic acid 3-(dimethylamino)propyl ester; chloride Formula: C14H22ClNO2 MolecularWeight: 271.78298

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CN(C)CCCOC(=O)CCC1=CC=CC=C1.[Cl-]

Isomeric SMILES

[H+].CN(C)CCCOC(=O)CCC1=CC=CC=C1.[Cl-]

InChI

InChI=1S/C14H21NO2.ClH/c1-15(2)11-6-12-17-14(16)10-9-13-7-4-3-5-8-13;/h3-5,7-8H,6,9-12H2,1-2H3;1H