hydron; (1-methylpiperidin-3-yl) 3-methoxybenzoate; chloride

Systemtic Name: hydron; (1-methylpiperidin-3-yl) 3-methoxybenzoate; chloride Openeye Name: hydron; (1-methyl-3-piperidyl) 3-methoxybenzoate; chloride CAS Name: hydron; 3-methoxybenzoic acid (1-methyl-3-piperidinyl) ester; chloride IUPAC Name: hydron; (1-methylpiperidin-3-yl) 3-methoxybenzoate; chloride Traditional Name: hydron; 3-methoxybenzoic acid (1-methyl-3-piperidyl) ester; chloride Formula: C14H20ClNO3 MolecularWeight: 285.7665

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CN1CCCC(C1)OC(=O)C2=CC(=CC=C2)OC.[Cl-]

Isomeric SMILES

[H+].CN1CCCC(C1)OC(=O)C2=CC(=CC=C2)OC.[Cl-]

InChI

InChI=1S/C14H19NO3.ClH/c1-15-8-4-7-13(10-15)18-14(16)11-5-3-6-12(9-11)17-2;/h3,5-6,9,13H,4,7-8,10H2,1-2H3;1H