tert-butyl N-(2-azanylethyl)carbamate; hydron; chloride

Systemtic Name: tert-butyl N-(2-azanylethyl)carbamate; hydron; chloride Openeye Name: tert-butyl N-(2-aminoethyl)carbamate; hydron; chloride CAS Name: N-(2-aminoethyl)carbamic acid tert-butyl ester; hydron; chloride IUPAC Name: tert-butyl N-(2-aminoethyl)carbamate; hydron; chloride Traditional Name: N-(2-aminoethyl)carbamic acid tert-butyl ester; hydron; chloride Formula: C7H17ClN2O2 MolecularWeight: 196.67508

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CC(C)(C)OC(=O)NCCN.[Cl-]

Isomeric SMILES

[H+].CC(C)(C)OC(=O)NCCN.[Cl-]

InChI

InChI=1S/C7H16N2O2.ClH/c1-7(2,3)11-6(10)9-5-4-8;/h4-5,8H2,1-3H3,(H,9,10);1H