tert-butyl 2-(methylamino)ethanoate; hydron; chloride

Systemtic Name: tert-butyl 2-(methylamino)ethanoate; hydron; chloride Openeye Name: tert-butyl 2-(methylamino)acetate; hydron; chloride CAS Name: hydron; 2-(methylamino)acetic acid tert-butyl ester; chloride IUPAC Name: tert-butyl 2-(methylamino)acetate; hydron; chloride Traditional Name: hydron; 2-(methylamino)acetic acid tert-butyl ester; chloride Formula: C7H16ClNO2 MolecularWeight: 181.66044

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CC(C)(C)OC(=O)CNC.[Cl-]

Isomeric SMILES

[H+].CC(C)(C)OC(=O)CNC.[Cl-]

InChI

InChI=1S/C7H15NO2.ClH/c1-7(2,3)10-6(9)5-8-4;/h8H,5H2,1-4H3;1H