hydron; methyl 5-azanyl-4-oxidanylidene-pentanoate; chloride

Systemtic Name: hydron; methyl 5-azanyl-4-oxidanylidene-pentanoate; chloride Openeye Name: hydron; methyl 5-amino-4-oxo-pentanoate; chloride CAS Name: 5-amino-4-oxopentanoic acid methyl ester; hydron; chloride IUPAC Name: hydron; methyl 5-amino-4-oxopentanoate; chloride Traditional Name: 5-amino-4-keto-valeric acid methyl ester; hydron; chloride Formula: C6H12ClNO3 MolecularWeight: 181.61738

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].COC(=O)CCC(=O)CN.[Cl-]

Isomeric SMILES

[H+].COC(=O)CCC(=O)CN.[Cl-]

InChI

InChI=1S/C6H11NO3.ClH/c1-10-6(9)3-2-5(8)4-7;/h2-4,7H2,1H3;1H