hydron; methyl 2-azanyl-3-(1H-indol-3-yl)propanoate; chloride

Systemtic Name: hydron; methyl 2-azanyl-3-(1H-indol-3-yl)propanoate; chloride Openeye Name: hydron; methyl 2-amino-3-(1H-indol-3-yl)propanoate; chloride CAS Name: 2-amino-3-(1H-indol-3-yl)propanoic acid methyl ester; hydron; chloride IUPAC Name: hydron; methyl 2-amino-3-(1H-indol-3-yl)propanoate; chloride Traditional Name: 2-amino-3-(1H-indol-3-yl)propionic acid methyl ester; hydron; chloride Formula: C12H15ClN2O2 MolecularWeight: 254.7127

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].COC(=O)C(CC1=CNC2=CC=CC=C21)N.[Cl-]

Isomeric SMILES

[H+].COC(=O)C(CC1=CNC2=CC=CC=C21)N.[Cl-]

InChI

InChI=1S/C12H14N2O2.ClH/c1-16-12(15)10(13)6-8-7-14-11-5-3-2-4-9(8)11;/h2-5,7,10,14H,6,13H2,1H3;1H