hydron; methyl 2-(azepan-1-yl)-2-phenyl-ethanoate; chloride

Systemtic Name: hydron; methyl 2-(azepan-1-yl)-2-phenyl-ethanoate; chloride Openeye Name: hydron; methyl 2-(azepan-1-yl)-2-phenyl-acetate; chloride CAS Name: 2-(1-azepanyl)-2-phenylacetic acid methyl ester; hydron; chloride IUPAC Name: hydron; methyl 2-(azepan-1-yl)-2-phenylacetate; chloride Traditional Name: 2-(azepan-1-yl)-2-phenyl-acetic acid methyl ester; hydron; chloride Formula: C15H22ClNO2 MolecularWeight: 283.79368

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].COC(=O)C(C1=CC=CC=C1)N2CCCCCC2.[Cl-]

Isomeric SMILES

[H+].COC(=O)C(C1=CC=CC=C1)N2CCCCCC2.[Cl-]

InChI

InChI=1S/C15H21NO2.ClH/c1-18-15(17)14(13-9-5-4-6-10-13)16-11-7-2-3-8-12-16;/h4-6,9-10,14H,2-3,7-8,11-12H2,1H3;1H