hydron; 2-piperidin-1-ylethyl 2-phenylethanoate; chloride

Systemtic Name: hydron; 2-piperidin-1-ylethyl 2-phenylethanoate; chloride Openeye Name: hydron; 2-(1-piperidyl)ethyl 2-phenylacetate; chloride CAS Name: hydron; 2-phenylacetic acid 2-(1-piperidinyl)ethyl ester; chloride IUPAC Name: hydron; 2-piperidin-1-ylethyl 2-phenylacetate; chloride Traditional Name: hydron; 2-phenylacetic acid 2-piperidinoethyl ester; chloride Formula: C15H22ClNO2 MolecularWeight: 283.79368

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].C1CCN(CC1)CCOC(=O)CC2=CC=CC=C2.[Cl-]

Isomeric SMILES

[H+].C1CCN(CC1)CCOC(=O)CC2=CC=CC=C2.[Cl-]

InChI

InChI=1S/C15H21NO2.ClH/c17-15(13-14-7-3-1-4-8-14)18-12-11-16-9-5-2-6-10-16;/h1,3-4,7-8H,2,5-6,9-13H2;1H