hydron; 2-piperidin-1-ylethyl 1-benzofuran-2-carboxylate; chloride

Systemtic Name: hydron; 2-piperidin-1-ylethyl 1-benzofuran-2-carboxylate; chloride Openeye Name: hydron; 2-(1-piperidyl)ethyl benzofuran-2-carboxylate; chloride CAS Name: 2-benzofurancarboxylic acid 2-(1-piperidinyl)ethyl ester; hydron; chloride IUPAC Name: hydron; 2-piperidin-1-ylethyl 1-benzofuran-2-carboxylate; chloride Traditional Name: coumarilic acid 2-piperidinoethyl ester; hydron; chloride Formula: C16H20ClNO3 MolecularWeight: 309.7879

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].C1CCN(CC1)CCOC(=O)C2=CC3=CC=CC=C3O2.[Cl-]

Isomeric SMILES

[H+].C1CCN(CC1)CCOC(=O)C2=CC3=CC=CC=C3O2.[Cl-]

InChI

InChI=1S/C16H19NO3.ClH/c18-16(19-11-10-17-8-4-1-5-9-17)15-12-13-6-2-3-7-14(13)20-15;/h2-3,6-7,12H,1,4-5,8-11H2;1H