hydron; (1-methylpiperidin-3-yl) 2-phenoxyethanoate; chloride

Systemtic Name: hydron; (1-methylpiperidin-3-yl) 2-phenoxyethanoate; chloride Openeye Name: hydron; (1-methyl-3-piperidyl) 2-phenoxyacetate; chloride CAS Name: hydron; 2-phenoxyacetic acid (1-methyl-3-piperidinyl) ester; chloride IUPAC Name: hydron; (1-methylpiperidin-3-yl) 2-phenoxyacetate; chloride Traditional Name: hydron; 2-phenoxyacetic acid (1-methyl-3-piperidyl) ester; chloride Formula: C14H20ClNO3 MolecularWeight: 285.7665

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CN1CCCC(C1)OC(=O)COC2=CC=CC=C2.[Cl-]

Isomeric SMILES

[H+].CN1CCCC(C1)OC(=O)COC2=CC=CC=C2.[Cl-]

InChI

InChI=1S/C14H19NO3.ClH/c1-15-9-5-8-13(10-15)18-14(16)11-17-12-6-3-2-4-7-12;/h2-4,6-7,13H,5,8-11H2,1H3;1H