ethyl 4-azanylbenzoate; hydron; chloride

Systemtic Name: ethyl 4-azanylbenzoate; hydron; chloride Openeye Name: ethyl 4-aminobenzoate; hydron; chloride CAS Name: 4-aminobenzoic acid ethyl ester; hydron; chloride IUPAC Name: ethyl 4-aminobenzoate; hydron; chloride Traditional Name: 4-aminobenzoic acid ethyl ester; hydron; chloride Formula: C9H12ClNO2 MolecularWeight: 201.65008

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CCOC(=O)C1=CC=C(C=C1)N.[Cl-]

Isomeric SMILES

[H+].CCOC(=O)C1=CC=C(C=C1)N.[Cl-]

InChI

InChI=1S/C9H11NO2.ClH/c1-2-12-9(11)7-3-5-8(10)6-4-7;/h3-6H,2,10H2,1H3;1H