ethyl (2S,3S)-2-azanyl-3-methyl-pentanoate; hydron; chloride

Systemtic Name: ethyl (2S,3S)-2-azanyl-3-methyl-pentanoate; hydron; chloride Openeye Name: ethyl (2S,3S)-2-amino-3-methyl-pentanoate; hydron; chloride CAS Name: (2S,3S)-2-amino-3-methylpentanoic acid ethyl ester; hydron; chloride IUPAC Name: ethyl (2S,3S)-2-amino-3-methylpentanoate; hydron; chloride Traditional Name: (2S,3S)-2-amino-3-methyl-valeric acid ethyl ester; hydron; chloride Formula: C8H18ClNO2 MolecularWeight: 195.68702

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CCC(C)C(C(=O)OCC)N.[Cl-]

Isomeric SMILES

[H+].CC[C@H](C)[C@@H](C(=O)OCC)N.[Cl-]

InChI

InChI=1S/C8H17NO2.ClH/c1-4-6(3)7(9)8(10)11-5-2;/h6-7H,4-5,9H2,1-3H3;1H/t6-,7-;/m0./s1