ethanoyl ethanoate; hydron; chloride

Systemtic Name: ethanoyl ethanoate; hydron; chloride Openeye Name: acetyl acetate; hydron; chloride CAS Name: acetic acid acetyl ester; hydron; chloride IUPAC Name: acetyl acetate; hydron; chloride Traditional Name: acetic acid acetyl ester; hydron; chloride Formula: C4H7ClO3 MolecularWeight: 138.54958

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CC(=O)OC(=O)C.[Cl-]

Isomeric SMILES

[H+].CC(=O)OC(=O)C.[Cl-]

InChI

InChI=1S/C4H6O3.ClH/c1-3(5)7-4(2)6;/h1-2H3;1H