carbon monoxide; iron; 3-methylbutanoic acid

Systemtic Name: carbon monoxide; iron; 3-methylbutanoic acid Openeye Name: carbon monoxide; iron; 3-methylbutanoic acid CAS Name: carbon monoxide; iron; 3-methylbutanoic acid IUPAC Name: carbon monoxide; iron; 3-methylbutanoic acid Traditional Name: carbon monoxide; iron; 3-methylbutyric acid Formula: C8H6FeO5 MolecularWeight: 237.97524

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[CH2][C]([CH2])[CH]C(=O)O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe]

Isomeric SMILES

[CH2][C]([CH2])[CH]C(=O)O.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe]

InChI

InChI=1S/C5H6O2.3CO.Fe/c1-4(2)3-5(6)7;3*1-2;/h3H,1-2H2,(H,6,7);;;;