3-azanylpropyl(phenethyl)phosphinic acid; hydron; chloride

Systemtic Name: 3-azanylpropyl(phenethyl)phosphinic acid; hydron; chloride Openeye Name: 3-aminopropyl(phenethyl)phosphinic acid; hydron; chloride CAS Name: 3-aminopropyl(phenethyl)phosphinic acid; hydron; chloride IUPAC Name: 3-aminopropyl(phenethyl)phosphinic acid; hydron; chloride Traditional Name: 3-aminopropyl(phenethyl)phosphinic acid; hydron; chloride Formula: C11H19ClNO2P MolecularWeight: 263.700821

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].C1=CC=C(C=C1)CCP(=O)(CCCN)O.[Cl-]

Isomeric SMILES

[H+].C1=CC=C(C=C1)CCP(=O)(CCCN)O.[Cl-]

InChI

InChI=1S/C11H18NO2P.ClH/c12-8-4-9-15(13,14)10-7-11-5-2-1-3-6-11;/h1-3,5-6H,4,7-10,12H2,(H,13,14);1H