2-dimethylaminoethyl 3-phenylpropanoate; hydron; chloride

Systemtic Name: 2-dimethylaminoethyl 3-phenylpropanoate; hydron; chloride Openeye Name: 2-dimethylaminoethyl 3-phenylpropanoate; hydron; chloride CAS Name: hydron; 3-phenylpropanoic acid 2-dimethylaminoethyl ester; chloride IUPAC Name: 2-dimethylaminoethyl 3-phenylpropanoate; hydron; chloride Traditional Name: hydron; 3-phenylpropionic acid 2-dimethylaminoethyl ester; chloride Formula: C13H20ClNO2 MolecularWeight: 257.7564

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CN(C)CCOC(=O)CCC1=CC=CC=C1.[Cl-]

Isomeric SMILES

[H+].CN(C)CCOC(=O)CCC1=CC=CC=C1.[Cl-]

InChI

InChI=1S/C13H19NO2.ClH/c1-14(2)10-11-16-13(15)9-8-12-6-4-3-5-7-12;/h3-7H,8-11H2,1-2H3;1H