2-diethylaminoethyl 3-methoxybenzoate; hydron; chloride

Systemtic Name: 2-diethylaminoethyl 3-methoxybenzoate; hydron; chloride Openeye Name: 2-diethylaminoethyl 3-methoxybenzoate; hydron; chloride CAS Name: hydron; 3-methoxybenzoic acid 2-diethylaminoethyl ester; chloride IUPAC Name: 2-diethylaminoethyl 3-methoxybenzoate; hydron; chloride Traditional Name: hydron; 3-methoxybenzoic acid 2-diethylaminoethyl ester; chloride Formula: C14H22ClNO3 MolecularWeight: 287.78238

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CCN(CC)CCOC(=O)C1=CC(=CC=C1)OC.[Cl-]

Isomeric SMILES

[H+].CCN(CC)CCOC(=O)C1=CC(=CC=C1)OC.[Cl-]

InChI

InChI=1S/C14H21NO3.ClH/c1-4-15(5-2)9-10-18-14(16)12-7-6-8-13(11-12)17-3;/h6-8,11H,4-5,9-10H2,1-3H3;1H