2-diethylaminoethyl 3-chloranylbenzoate; hydron; chloride

Systemtic Name: 2-diethylaminoethyl 3-chloranylbenzoate; hydron; chloride Openeye Name: 2-diethylaminoethyl 3-chlorobenzoate; hydron; chloride CAS Name: 3-chlorobenzoic acid 2-diethylaminoethyl ester; hydron; chloride IUPAC Name: 2-diethylaminoethyl 3-chlorobenzoate; hydron; chloride Traditional Name: 3-chlorobenzoic acid 2-diethylaminoethyl ester; hydron; chloride Formula: C13H19Cl2NO2 MolecularWeight: 292.20146

Click to see the large picture

Descriptors Computed from Structure

Canonical SMILES:

[H+].CCN(CC)CCOC(=O)C1=CC(=CC=C1)Cl.[Cl-]

Isomeric SMILES

[H+].CCN(CC)CCOC(=O)C1=CC(=CC=C1)Cl.[Cl-]

InChI

InChI=1S/C13H18ClNO2.ClH/c1-3-15(4-2)8-9-17-13(16)11-6-5-7-12(14)10-11;/h5-7,10H,3-4,8-9H2,1-2H3;1H